made things better, probably usable, definitely not final

This commit is contained in:
Bill Zorn 2015-07-07 02:26:09 -07:00
parent 7db63b9b56
commit 01c78549f5

View file

@ -1,25 +1,9 @@
import re import re
import codecs import codecs
import sys import sys
import random
# grab the characters we need out of encode import utils
# really we should probably make a settings file with that stuff in it
import encode
# global helpers
def prettymana(s, for_forum):
# this agorithm is pretty generic, intended fro use on Manacost.symbols keys
if len(s) == 1:
if for_forum:
return '[mana]' + s + '[/mana]'
else:
return '{' + s + '}'
elif len(s) == 2:
if for_forum:
return '[mana]{' + s[0] + '/' + s[1] + '}[/mana]'
else:
return '{' + s[0] + '/' + s[1] + '}'
# format a list of rows of data into nice columns # format a list of rows of data into nice columns
def padrows(l): def padrows(l):
@ -40,7 +24,11 @@ def padrows(l):
pad = ' ' * (lens[i] - len(s)) pad = ' ' * (lens[i] - len(s))
padded[-1] += (s + pad + ' ') padded[-1] += (s + pad + ' ')
return padded return padded
def printrows(l):
for row in l:
print row
# so this stuff still needs to be cleaned up
punctuation_chars = r'[+\-*",.:;WUBRGPV/XTQ|\\&^\{\}@ \n=~%\[\]]' punctuation_chars = r'[+\-*",.:;WUBRGPV/XTQ|\\&^\{\}@ \n=~%\[\]]'
creature_keywords = [ creature_keywords = [
# evergreen # evergreen
@ -111,6 +99,7 @@ creature_keywords = [
class Manacost: class Manacost:
'''mana cost representation with data''' '''mana cost representation with data'''
# hardcoded to be dependent on the symbol structure... ah well
def get_colors(self): def get_colors(self):
colors = '' colors = ''
for sym in self.symbols: for sym in self.symbols:
@ -119,7 +108,8 @@ class Manacost:
for symcolor in symcolors: for symcolor in symcolors:
if symcolor not in colors: if symcolor not in colors:
colors += symcolor colors += symcolor
return colors # sort so the order is always consistent
return ''.join(sorted(colors))
def check_colors(self, symbolstring): def check_colors(self, symbolstring):
for sym in symbolstring: for sym in symbolstring:
@ -132,36 +122,8 @@ class Manacost:
self.cmc = 0 self.cmc = 0
self.colorless = 0 self.colorless = 0
self.sequence = [] self.sequence = []
self.symbols = { self.symbols = {sym : 0 for sym in utils.mana_syms}
'W' : 0, # single color self.allsymbols = {sym : 0 for sym in utils.mana_symall}
'U' : 0,
'B' : 0,
'R' : 0,
'G' : 0,
'P' : 0, # colorless phyrexian
'S' : 0, # snow
'X' : 0, # number of x symbols
'WP' : 0, # single color phyrexian
'UP' : 0,
'BP' : 0,
'RP' : 0,
'GP' : 0,
'2W' : 0, # single color hybrid
'2U' : 0,
'2B' : 0,
'2R' : 0,
'2G' : 0,
'WU' : 0, # dual color hybrid
'WB' : 0,
'RW' : 0,
'GW' : 0,
'UB' : 0,
'UR' : 0,
'GU' : 0,
'BR' : 0,
'BG' : 0,
'RG' : 0,
}
if text == '': if text == '':
self._parsed = True self._parsed = True
@ -180,89 +142,61 @@ class Manacost:
self.none = False self.none = False
self.inner = self.raw[1:-1] self.inner = self.raw[1:-1]
trans_decode = { # structure mirrors the decoding in utils, but we pull out different data here
'WW' : 'W', idx = 0
'UU' : 'U', while idx < len(self.inner):
'BB' : 'B', # taking this branch is an infinite loop if unary_marker is empty
'RR' : 'R', if (len(utils.mana_unary_marker) > 0 and
'GG' : 'G', self.inner[idx:idx+len(utils.mana_unary_marker)] == utils.mana_unary_marker):
'PP' : 'P', idx += len(utils.mana_unary_marker)
'SS' : 'S', self.sequence += [utils.mana_unary_marker]
'XX' : 'X', elif self.inner[idx:idx+len(utils.mana_unary_counter)] == utils.mana_unary_counter:
'WP' : 'WP', idx += len(utils.mana_unary_counter)
'UP' : 'UP', self.sequence += [utils.mana_unary_counter]
'BP' : 'BP',
'RP' : 'RP',
'GP' : 'GP',
'VW' : '2W',
'VU' : '2U',
'VB' : '2B',
'VR' : '2R',
'VG' : '2G',
'WU' : 'WU',
'WB' : 'WB',
'RW' : 'RW',
'GW' : 'GW',
'UB' : 'UB',
'UR' : 'UR',
'GU' : 'GU',
'BR' : 'BR',
'BG' : 'BG',
'RG' : 'RG',
}
# read the symbols in a loop
inner_current = self.inner
while len(inner_current) > 0:
# look for counters to get the colorless cost
if inner_current[:1] == encode.unary_counter:
self.colorless += 1 self.colorless += 1
self.cmc += 1 self.cmc += 1
inner_current = inner_current[1:]
# or look for symbols to read
elif inner_current[:2] in trans_decode:
sym = trans_decode[inner_current[:2]]
self.sequence += [sym]
self.symbols[sym] += 1
if sym == 'X':
self.cmc += 0
elif sym[:1] == '2':
self.cmc += 2
else:
self.cmc += 1
inner_current = inner_current[2:]
# if we don't recognize the symbol, bail out
else: else:
self._valid = False old_idx = idx
break for symlen in range(utils.mana_symlen_min, utils.mana_symlen_max + 1):
encoded_sym = self.inner[idx:idx+symlen]
if encoded_sym in utils.mana_symall_decode:
idx += symlen
# leave the sequence encoded for convenience
self.sequence += [encoded_sym]
sym = utils.mana_symall_decode[encoded_sym]
self.allsymbols[sym] += 1
if sym in utils.mana_symalt:
self.symbols[utils.mana_alt(sym)] += 1
else:
self.symbols[sym] += 1
if sym == utils.mana_X:
self.cmc += 0
elif utils.mana_2 in sym:
self.cmc += 2
else:
self.cmc += 1
break
# otherwise we'll go into an infinite loop if we see a symbol we don't know
if idx == old_idx:
idx += 1
self._valid = False
self.colors = self.get_colors() self.colors = self.get_colors()
def __str__(self): def __str__(self):
if self.colorless == 0 and self.sequence == []: return utils.mana_untranslate(''.join(self.sequence))
return '{0}'
else:
if self.colorless > 0:
colorless_part = '{' + str(self.colorless) + '}'
else:
colorless_part = ''
return colorless_part + ''.join(map(lambda s: prettymana(s, False), self.sequence))
def format(self, for_forum): def format(self, for_forum):
if self.colorless == 0 and self.sequence == []: return utils.mana_untranslate(''.join(self.sequence, for_forum))
if for_forum:
return '[mana]0[/mana]' def reencode(self, randomize = False):
else: if randomize:
return '{0}' # so this won't work very well if mana_unary_marker isn't empty
return (utils.mana_open_delimiter
+ ''.join(random.sample(self.sequence, len(self.sequence)))
+ utils.mana_close_delimiter)
else: else:
if self.colorless > 0: return utils.mana_open_delimiter + ''.join(self.sequence) + utils.mana_close_delimiter
if for_forum:
colorless_part = '[mana]{' + str(self.colorless) + '}[/mana]'
else:
colorless_part = '{' + str(self.colorless) + '}'
else:
colorless_part = ''
return colorless_part + ''.join(map(lambda s: prettymana(s, for_forum), self.sequence))
class Card: class Card:
'''card representation with data''' '''card representation with data'''
@ -287,7 +221,7 @@ class Card:
else: else:
self.bside = None self.bside = None
fields = self.raw.split(encode.fieldsep) fields = self.raw.split(utils.fieldsep)
if not len(fields) >= 10: if not len(fields) >= 10:
self._parsed = False self._parsed = False
self._valid = False self._valid = False
@ -334,23 +268,23 @@ class Card:
if not fields[6] == '': if not fields[6] == '':
self.pt = fields[6] self.pt = fields[6]
self.power = None
self.power_value = None
self.toughness = None
self.toughness_value = None
p_t = self.pt.split('/') p_t = self.pt.split('/')
if len(p_t) == 2: if len(p_t) == 2:
self.power = p_t[0] self.power = p_t[0]
try: try:
self.power_value = int(self.power) self.power_value = int(self.power)
except ValueError: except ValueError:
self.power_value = None self.power_value = None
self.toughness = p_t[1] self.toughness = p_t[1]
try: try:
self.toughness_value = int(self.toughness) self.toughness_value = int(self.toughness)
except ValueError: except ValueError:
self.toughness_value = None self.toughness_value = None
else: else:
self.power = None
self.power_value = None
self.toughess = None
self.toughness_value = None
self._valid = False self._valid = False
else: else:
self.pt = None self.pt = None
@ -364,7 +298,7 @@ class Card:
if not fields[8] == '': if not fields[8] == '':
self.text = fields[8] self.text = fields[8]
self.text_lines = self.text.split(encode.newline) self.text_lines = self.text.split(utils.newline)
self.text_words = re.sub(punctuation_chars, ' ', self.text).split() self.text_words = re.sub(punctuation_chars, ' ', self.text).split()
self.creature_words = [] self.creature_words = []
# SUPER HACK # SUPER HACK
@ -384,102 +318,201 @@ class Card:
# elif len(guess) > 0 and len(line) < 30: # elif len(guess) > 0 and len(line) < 30:
# print orig_line # print orig_line
else: else:
self.text = None self.text = ''
self.text_lines = [] self.text_lines = []
self.text_words = [] self.text_words = []
self.creature_words = [] self.creature_words = []
if len(fields) > 10:
self.cost2 = Manacost(fields[9])
else:
self.cost2 = None
def __str__(self): def __str__(self):
return ''.join([ return ''.join([
encode.fieldsep, utils.fieldsep,
self.name, self.name,
encode.fieldsep, utils.fieldsep,
(' ' + encode.dash_marker + ' ').join([' '.join(self.supertypes + self.types), (' ' + utils.dash_marker + ' ').join([' '.join(self.supertypes + self.types),
' '.join(self.subtypes)]), ' '.join(self.subtypes)]),
encode.fieldsep, utils.fieldsep,
str(self.cost.cmc) if self.cost.colors == '' str(self.cost.cmc) if self.cost.colors == ''
else str(self.cost.cmc) + ', ' + self.cost.colors, else str(self.cost.cmc) + ', ' + self.cost.colors,
encode.fieldsep, utils.fieldsep,
])
def reencode(self, randomize = False):
return ''.join([
utils.fieldsep,
self.name,
utils.fieldsep,
' '.join(self.supertypes),
utils.fieldsep,
' '.join(self.types),
utils.fieldsep,
self.loyalty if self.loyalty else '',
utils.fieldsep,
' '.join(self.subtypes),
utils.fieldsep,
self.pt if self.pt else '',
utils.fieldsep,
self.cost.reencode(randomize) if not self.cost.none else '',
utils.fieldsep,
self.text,
utils.fieldsep,
utils.bsidesep + self.bside.reencode(randomize) if self.bside else '',
]) ])
# global card pools
unparsed_cards = []
invalid_cards = []
cards = []
allcards = []
# global indices
by_name = {}
by_type = {}
by_type_inclusive = {}
by_supertype = {}
by_supertype_inclusive = {}
by_subtype = {}
by_subtype_inclusive = {}
by_color = {}
by_color_inclusive = {}
by_cmc = {}
by_cost = {}
by_power = {}
by_toughness = {}
by_pt = {}
by_loyalty = {}
by_textlines = {}
by_textlen = {}
def inc(d, k, obj):
if k:
if k in d:
d[k] += obj
else:
d[k] = obj
# build the global indices
def analyze(cardtexts):
global unparsed_cards, invalid_cards, cards, allcards
for cardtext in cardtexts:
# the empty card is not interesting
if not cardtext:
continue
card = Card(cardtext)
if card._valid:
cards += [card]
allcards += [card]
elif card._parsed:
invalid_cards += [card]
allcards += [card]
else:
unparsed_cards += [card]
if card._parsed:
inc(by_name, card.name, [card])
inc(by_type, ' '.join(card.types), [card])
for t in card.types:
inc(by_type_inclusive, t, [card])
inc(by_supertype, ' '.join(card.supertypes), [card])
for t in card.supertypes:
inc(by_supertype_inclusive, t, [card])
inc(by_subtype, ' '.join(card.subtypes), [card])
for t in card.subtypes:
inc(by_subtype_inclusive, t, [card])
if card.cost.colors:
inc(by_color, card.cost.colors, [card])
for c in card.cost.colors:
inc(by_color_inclusive, c, [card])
else:
# colorless, still want to include in these tables
inc(by_color, 'A', [card])
inc(by_color_inclusive, 'A', [card])
inc(by_cmc, card.cost.cmc, [card])
inc(by_cost, card.cost.reencode(), [card])
inc(by_power, card.power, [card])
inc(by_toughness, card.toughness, [card])
inc(by_pt, card.pt, [card])
inc(by_loyalty, card.loyalty, [card])
inc(by_textlines, len(card.text_lines), [card])
inc(by_textlen, len(card.text), [card])
# summarize the indices
def summarize():
print '===================='
print str(len(cards)) + ' valid cards, ' + str(len(invalid_cards)) + ' invalid cards.'
print str(len(allcards)) + ' cards parsed, ' + str(len(unparsed_cards)) + ' failed to parse'
print '--------------------'
print str(len(by_name)) + ' unique card names'
print '--------------------'
print (str(len(by_color)) + ' represented colors (including colorless as \'A\'), '
+ str(len(by_color_inclusive)) + ' combinations')
print 'Breakdown by color:'
rows = [by_color_inclusive.keys()]
rows += [[len(by_color_inclusive[k]) for k in rows[0]]]
printrows(padrows(rows))
print '--------------------'
print str(len(by_type_inclusive)) + ' unique card types, ' + str(len(by_type)) + ' combinations'
print 'Breakdown by type:'
d = sorted(by_type_inclusive,
lambda x,y: cmp(len(by_type_inclusive[x]), len(by_type_inclusive[y])),
reverse = True)
rows = [[k for k in d[:10]]]
rows += [[len(by_type_inclusive[k]) for k in rows[0]]]
printrows(padrows(rows))
print '--------------------'
print (str(len(by_subtype_inclusive)) + ' unique subtypes, '
+ str(len(by_subtype)) + ' combinations')
print '-- Popular subtypes: --'
d = sorted(by_subtype_inclusive,
lambda x,y: cmp(len(by_subtype_inclusive[x]), len(by_subtype_inclusive[y])),
reverse = True)
rows = []
for k in d[0:10]:
rows += [[k, len(by_subtype_inclusive[k])]]
printrows(padrows(rows))
print '-- Top combinations: --'
d = sorted(by_subtype,
lambda x,y: cmp(len(by_subtype[x]), len(by_subtype[y])),
reverse = True)
rows = []
for k in d[0:10]:
rows += [[k, len(by_subtype[k])]]
printrows(padrows(rows))
print '--------------------'
print (str(len(by_supertype_inclusive)) + ' unique supertypes, '
+ str(len(by_supertype)) + ' combinations')
print 'Breakdown by supertype:'
d = sorted(by_supertype_inclusive,
lambda x,y: cmp(len(by_supertype_inclusive[x]),len(by_supertype_inclusive[y])),
reverse = True)
rows = [[k for k in d]]
rows += [[len(by_supertype_inclusive[k]) for k in rows[0]]]
printrows(padrows(rows))
print '===================='
# TODO: more to come
# describe outliers in the indices
def outliers():
pass
def main(fname, oname = None, verbose = False): def main(fname, oname = None, verbose = False):
if verbose: if verbose:
print 'Opening encoded card file: ' + fname print 'Opening encoded card file: ' + fname
f = open(fname, 'r') with open(fname, 'rt') as f:
text = f.read() text = f.read()
f.close()
# we get rid of the first and last because they are probably partial cardtexts = text.split(utils.cardsep)
cardtexts = text.split('\n\n')[1:-1] analyze(cardtexts)
cards = [] summarize()
outliers()
creatures = 0
cwords = 0
allwords = {}
correct = 0
correct_len = 0
incorrect = 0
incorrect_len = 0
i = 0
for cardtext in cardtexts:
i += 1
card = Card(cardtext)
if not (card._parsed and card._valid):
print card.raw
continue
cards += [card]
if not str(card.cost) == str(card.cost2):
if not card.cost2.check_colors(card.cost.colors):
print card.raw + '\n'
incorrect += 1
if card.text:
incorrect_len += len(card.text)
else:
correct += 1
if card.text:
correct_len += len(card.text)
if 'creature' in card.types:
creatures += 1
if card.creature_words:
cwords += 1
for word in card.text_words:
if word in allwords:
allwords[word] += 1
else:
allwords[word] = 1
print '\n====================\n'
for card in cards:
if (not str(card.cost) == str(card.cost2)) and card.cost2.check_colors(card.cost.colors):
print card.raw + '\n'
print '\n====================\n'
for card in cards:
if str(card.cost) == str(card.cost2):
print card.raw + '\n'
print '\n====================\n'
print str(creatures) + ' creatures, ' + str(cwords) + ' with keywords'
print str(len(allwords)) + ' unique words in card text'
print str(incorrect) + ' cost mismatches, ' + str(correct) + ' cost matches.'
print str(incorrect_len / incorrect) + ' average length of cost mismatches.'
print str(correct_len / correct) + ' average length of cost matches.'
if __name__ == '__main__': if __name__ == '__main__':
import sys import sys